About 1-N-[1-[dimethoxy(methyl)silyl]propyl]-1-N',1-N'-dimethylpropane-1,1-diamine
1-N-[1-[dimethoxy(methyl)silyl]propyl]-1-N',1-N'-dimethylpropane-1,1-diamine (PubChem CID 141254492) has the molecular formula C11H28N2O2Si
and a molecular weight of 248.44 g/mol. Its IUPAC name is 1-N-[1-[dimethoxy(methyl)silyl]propyl]-1-N',1-N'-dimethylpropane-1,1-diamine.
Molecular Properties
| Compound Name | 1-N-[1-[dimethoxy(methyl)silyl]propyl]-1-N',1-N'-dimethylpropane-1,1-diamine |
| PubChem CID | 141254492 |
| Molecular Formula | C11H28N2O2Si |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-N-[1-[dimethoxy(methyl)silyl]propyl]-1-N',1-N'-dimethylpropane-1,1-diamine |
| SMILES | CCC(NC(CC)[Si](C)(OC)OC)N(C)C |
| InChI | InChI=1S/C11H28N2O2Si/c1-8-10(13(3)4)12-11(9-2)16(7,14-5)15-6/h10-12H,8-9H2,1-7H3 |
| InChIKey | PZGQWAQFWYVUGR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-N-[1-[dimethoxy(methyl)silyl]propyl]-1-N',1-N'-dimethylpropane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[1-[dimethoxy(methyl)silyl]propyl]-1-N',1-N'-dimethylpropane-1,1-diamine?
The IUPAC name of 1-N-[1-[dimethoxy(methyl)silyl]propyl]-1-N',1-N'-dimethylpropane-1,1-diamine (CID 141254492) is 1-N-[1-[dimethoxy(methyl)silyl]propyl]-1-N',1-N'-dimethylpropane-1,1-diamine.
What is the SMILES notation for 1-N-[1-[dimethoxy(methyl)silyl]propyl]-1-N',1-N'-dimethylpropane-1,1-diamine?
The canonical SMILES for 1-N-[1-[dimethoxy(methyl)silyl]propyl]-1-N',1-N'-dimethylpropane-1,1-diamine is CCC(NC(CC)[Si](C)(OC)OC)N(C)C.
What is the InChIKey of 1-N-[1-[dimethoxy(methyl)silyl]propyl]-1-N',1-N'-dimethylpropane-1,1-diamine?
The InChIKey is PZGQWAQFWYVUGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H28N2O2Si/c1-8-10(13(3)4)12-11(9-2)16(7,14-5)15-6/h10-12H,8-9H2,1-7H3.
What are the key properties of 1-N-[1-[dimethoxy(methyl)silyl]propyl]-1-N',1-N'-dimethylpropane-1,1-diamine?
1-N-[1-[dimethoxy(methyl)silyl]propyl]-1-N',1-N'-dimethylpropane-1,1-diamine has a molecular weight of 248.44 g/mol, XLogP of 1.56, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[1-[dimethoxy(methyl)silyl]propyl]-1-N',1-N'-dimethylpropane-1,1-diamine is sourced from PubChem (CID 141254492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).