C25H31N6O5+ — CID 141254991
1-methyl-3-[[(1S)-1-[5-(1,6-naphthyridin-2-yl)-1,3,4-oxadiazol-2-yl]-7-oxononyl]carbamoyl]azetidin-1-ium-1-carboxylic acid (PubChem CID 141254991) has the molecular formula C25H31N6O5+ and a molecular weight of 495.56 g/mol. Its IUPAC name is 1-methyl-3-[[(1S)-1-[5-(1,6-naphthyridin-2-yl)-1,3,4-oxadiazol-2-yl]-7-oxononyl]carbamoyl]azetidin-1-ium-1-carboxylic acid.
| Compound Name | 1-methyl-3-[[(1S)-1-[5-(1,6-naphthyridin-2-yl)-1,3,4-oxadiazol-2-yl]-7-oxononyl]carbamoyl]azetidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 141254991 |
| Molecular Formula | C25H31N6O5+ |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 1-methyl-3-[[(1S)-1-[5-(1,6-naphthyridin-2-yl)-1,3,4-oxadiazol-2-yl]-7-oxononyl]carbamoyl]azetidin-1-ium-1-carboxylic acid |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)C1C[N+](C)(C(=O)O)C1)c1nnc(-c2ccc3cnccc3n2)o1 |
| InChI | InChI=1S/C25H30N6O5/c1-3-18(32)7-5-4-6-8-20(28-22(33)17-14-31(2,15-17)25(34)35)23-29-30-24(36-23)21-10-9-16-13-26-12-11-19(16)27-21/h9-13,17,20H,3-8,14-15H2,1-2H3,(H-,28,33,34,35)/p+1/t17?,20-,31?/m0/s1 |
| InChIKey | FLCYVMBHOUYNRM-ONGQFPMISA-O |
| XLogP | 3.52 |
| TPSA | 148.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|