C72H100O4P2 — CID 141255569
[3-[4-bis(2,4-ditert-butyl-5-methylphenoxy)phosphanylphenyl]phenyl]-bis(2,4-ditert-butyl-5-methylphenoxy)phosphane (PubChem CID 141255569) has the molecular formula C72H100O4P2 and a molecular weight of 1091.54 g/mol. Its IUPAC name is [3-[4-bis(2,4-ditert-butyl-5-methylphenoxy)phosphanylphenyl]phenyl]-bis(2,4-ditert-butyl-5-methylphenoxy)phosphane.
| Compound Name | [3-[4-bis(2,4-ditert-butyl-5-methylphenoxy)phosphanylphenyl]phenyl]-bis(2,4-ditert-butyl-5-methylphenoxy)phosphane |
|---|---|
| PubChem CID | 141255569 |
| Molecular Formula | C72H100O4P2 |
| Molecular Weight | 1091.54 g/mol |
| Exact Mass | 1090.71 |
| IUPAC Name | [3-[4-bis(2,4-ditert-butyl-5-methylphenoxy)phosphanylphenyl]phenyl]-bis(2,4-ditert-butyl-5-methylphenoxy)phosphane |
| SMILES | Cc1cc(OP(Oc2cc(C)c(C(C)(C)C)cc2C(C)(C)C)c2ccc(-c3cccc(P(Oc4cc(C)c(C(C)(C)C)cc4C(C)(C)C)Oc4cc(C)c(C(C)(C)C)cc4C(C)(C)C)c3)cc2)c(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C72H100O4P2/c1-45-36-61(57(69(17,18)19)41-53(45)65(5,6)7)73-77(74-62-37-46(2)54(66(8,9)10)42-58(62)70(20,21)22)51-34-32-49(33-35-51)50-30-29-31-52(40-50)78(75-63-38-47(3)55(67(11,12)13)43-59(63)71(23,24)25)76-64-39-48(4)56(68(14,15)16)44-60(64)72(26,27)28/h29-44H,1-28H3 |
| InChIKey | OCMLEDVXFGTDRK-UHFFFAOYSA-N |
| XLogP | 21.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1091.54 |
| LogP ≤ 5 | 21.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|