C14H27NO3 — CID 141256335
(E,3S)-N,N-bis(2-methoxyethyl)-2,3-dimethylhex-4-enamide (PubChem CID 141256335) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is (E,3S)-N,N-bis(2-methoxyethyl)-2,3-dimethylhex-4-enamide.
| Compound Name | (E,3S)-N,N-bis(2-methoxyethyl)-2,3-dimethylhex-4-enamide |
|---|---|
| PubChem CID | 141256335 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | (E,3S)-N,N-bis(2-methoxyethyl)-2,3-dimethylhex-4-enamide |
| SMILES | C/C=C/[C@H](C)C(C)C(=O)N(CCOC)CCOC |
| InChI | InChI=1S/C14H27NO3/c1-6-7-12(2)13(3)14(16)15(8-10-17-4)9-11-18-5/h6-7,12-13H,8-11H2,1-5H3/b7-6+/t12-,13?/m0/s1 |
| InChIKey | LVXRMHRXINLPIU-LOJZCDLVSA-N |
| XLogP | 1.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|