About 2-[(2,3-dichlorophenyl)methyl]-5-naphthalen-2-yl-1H-imidazole
2-[(2,3-dichlorophenyl)methyl]-5-naphthalen-2-yl-1H-imidazole (PubChem CID 141256733) has the molecular formula C20H14Cl2N2
and a molecular weight of 353.25 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenyl)methyl]-5-naphthalen-2-yl-1H-imidazole.
Molecular Properties
| Compound Name | 2-[(2,3-dichlorophenyl)methyl]-5-naphthalen-2-yl-1H-imidazole |
| PubChem CID | 141256733 |
| Molecular Formula | C20H14Cl2N2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 2-[(2,3-dichlorophenyl)methyl]-5-naphthalen-2-yl-1H-imidazole |
| SMILES | Clc1cccc(Cc2ncc(-c3ccc4ccccc4c3)[nH]2)c1Cl |
| InChI | InChI=1S/C20H14Cl2N2/c21-17-7-3-6-16(20(17)22)11-19-23-12-18(24-19)15-9-8-13-4-1-2-5-14(13)10-15/h1-10,12H,11H2,(H,23,24) |
| InChIKey | ARSCNTAYCNTTHG-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(2,3-dichlorophenyl)methyl]-5-naphthalen-2-yl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3-dichlorophenyl)methyl]-5-naphthalen-2-yl-1H-imidazole?
The IUPAC name of 2-[(2,3-dichlorophenyl)methyl]-5-naphthalen-2-yl-1H-imidazole (CID 141256733) is 2-[(2,3-dichlorophenyl)methyl]-5-naphthalen-2-yl-1H-imidazole.
What is the SMILES notation for 2-[(2,3-dichlorophenyl)methyl]-5-naphthalen-2-yl-1H-imidazole?
The canonical SMILES for 2-[(2,3-dichlorophenyl)methyl]-5-naphthalen-2-yl-1H-imidazole is Clc1cccc(Cc2ncc(-c3ccc4ccccc4c3)[nH]2)c1Cl.
What is the InChIKey of 2-[(2,3-dichlorophenyl)methyl]-5-naphthalen-2-yl-1H-imidazole?
The InChIKey is ARSCNTAYCNTTHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14Cl2N2/c21-17-7-3-6-16(20(17)22)11-19-23-12-18(24-19)15-9-8-13-4-1-2-5-14(13)10-15/h1-10,12H,11H2,(H,23,24).
What are the key properties of 2-[(2,3-dichlorophenyl)methyl]-5-naphthalen-2-yl-1H-imidazole?
2-[(2,3-dichlorophenyl)methyl]-5-naphthalen-2-yl-1H-imidazole has a molecular weight of 353.25 g/mol, XLogP of 6.13, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-dichlorophenyl)methyl]-5-naphthalen-2-yl-1H-imidazole is sourced from PubChem (CID 141256733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).