C14H23N5O4 — CID 141256875
methyl (2S,3R,4S)-3-acetamido-4-azido-2-(diethylaminomethyl)-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 141256875) has the molecular formula C14H23N5O4 and a molecular weight of 325.37 g/mol. Its IUPAC name is methyl (2S,3R,4S)-3-acetamido-4-azido-2-(diethylaminomethyl)-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2S,3R,4S)-3-acetamido-4-azido-2-(diethylaminomethyl)-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 141256875 |
| Molecular Formula | C14H23N5O4 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | methyl (2S,3R,4S)-3-acetamido-4-azido-2-(diethylaminomethyl)-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CCN(CC)C[C@@H]1OC(C(=O)OC)=C[C@H](N=[N+]=[N-])[C@H]1NC(C)=O |
| InChI | InChI=1S/C14H23N5O4/c1-5-19(6-2)8-12-13(16-9(3)20)10(17-18-15)7-11(23-12)14(21)22-4/h7,10,12-13H,5-6,8H2,1-4H3,(H,16,20)/t10-,12-,13+/m0/s1 |
| InChIKey | YHCNLCUIAQAKOK-WCFLWFBJSA-N |
| XLogP | 0.97 |
| TPSA | 116.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|