C13H21N5O4 — CID 141256885
methyl (2S,3R,4S)-3-acetamido-4-azido-2-[[ethyl(methyl)amino]methyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 141256885) has the molecular formula C13H21N5O4 and a molecular weight of 311.34 g/mol. Its IUPAC name is methyl (2S,3R,4S)-3-acetamido-4-azido-2-[[ethyl(methyl)amino]methyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2S,3R,4S)-3-acetamido-4-azido-2-[[ethyl(methyl)amino]methyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 141256885 |
| Molecular Formula | C13H21N5O4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | methyl (2S,3R,4S)-3-acetamido-4-azido-2-[[ethyl(methyl)amino]methyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CCN(C)C[C@@H]1OC(C(=O)OC)=C[C@H](N=[N+]=[N-])[C@H]1NC(C)=O |
| InChI | InChI=1S/C13H21N5O4/c1-5-18(3)7-11-12(15-8(2)19)9(16-17-14)6-10(22-11)13(20)21-4/h6,9,11-12H,5,7H2,1-4H3,(H,15,19)/t9-,11-,12+/m0/s1 |
| InChIKey | IOKBJEVQMPSKOZ-ZMLRMANQSA-N |
| XLogP | 0.58 |
| TPSA | 116.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|