C17H32O4 — CID 141257038
2,2,6,6-tetramethyl-4,4-di(propan-2-yloxy)heptane-3,5-dione (PubChem CID 141257038) has the molecular formula C17H32O4 and a molecular weight of 300.44 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4,4-di(propan-2-yloxy)heptane-3,5-dione.
| Compound Name | 2,2,6,6-tetramethyl-4,4-di(propan-2-yloxy)heptane-3,5-dione |
|---|---|
| PubChem CID | 141257038 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 2,2,6,6-tetramethyl-4,4-di(propan-2-yloxy)heptane-3,5-dione |
| SMILES | CC(C)OC(OC(C)C)(C(=O)C(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C17H32O4/c1-11(2)20-17(21-12(3)4,13(18)15(5,6)7)14(19)16(8,9)10/h11-12H,1-10H3 |
| InChIKey | RNYCGYLVAGHYKT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|