methyl 2-methylidenebutanoate;prop-2-enoic acid

C9H14O4 — CID 141257126

IUPACmethyl 2-methylidenebutanoate;prop-2-enoic acid
SMILESC=C(CC)C(=O)OC.C=CC(=O)O
InChIInChI=1S/C6H10O2.C3H4O2/c1-4-5(2)6(7)8-3;1-2-3(4)5/h2,4H2,1,3H3;2H,1H2,(H,4,5)
InChIKeyWUMSVTXXFFCNOB-UHFFFAOYSA-N
MW186.21 g/mol
LogP1.38
Rot. Bonds3

About methyl 2-methylidenebutanoate;prop-2-enoic acid

methyl 2-methylidenebutanoate;prop-2-enoic acid (PubChem CID 141257126) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl 2-methylidenebutanoate;prop-2-enoic acid.

Molecular Properties

Compound Namemethyl 2-methylidenebutanoate;prop-2-enoic acid
PubChem CID141257126
Molecular FormulaC9H14O4
Molecular Weight186.21 g/mol
Exact Mass186.09
IUPAC Namemethyl 2-methylidenebutanoate;prop-2-enoic acid
SMILESC=C(CC)C(=O)OC.C=CC(=O)O
InChIInChI=1S/C6H10O2.C3H4O2/c1-4-5(2)6(7)8-3;1-2-3(4)5/h2,4H2,1,3H3;2H,1H2,(H,4,5)
InChIKeyWUMSVTXXFFCNOB-UHFFFAOYSA-N
XLogP1.38
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.21
LogP ≤ 51.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-methylidenebutanoate;prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-methylidenebutanoate;prop-2-enoic acid?
The IUPAC name of methyl 2-methylidenebutanoate;prop-2-enoic acid (CID 141257126) is methyl 2-methylidenebutanoate;prop-2-enoic acid.
What is the SMILES notation for methyl 2-methylidenebutanoate;prop-2-enoic acid?
The canonical SMILES for methyl 2-methylidenebutanoate;prop-2-enoic acid is C=C(CC)C(=O)OC.C=CC(=O)O.
What is the InChIKey of methyl 2-methylidenebutanoate;prop-2-enoic acid?
The InChIKey is WUMSVTXXFFCNOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C3H4O2/c1-4-5(2)6(7)8-3;1-2-3(4)5/h2,4H2,1,3H3;2H,1H2,(H,4,5).
What are the key properties of methyl 2-methylidenebutanoate;prop-2-enoic acid?
methyl 2-methylidenebutanoate;prop-2-enoic acid has a molecular weight of 186.21 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylidenebutanoate;prop-2-enoic acid is sourced from PubChem (CID 141257126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).