About methyl 2-methylidenebutanoate;prop-2-enoic acid
methyl 2-methylidenebutanoate;prop-2-enoic acid (PubChem CID 141257126) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl 2-methylidenebutanoate;prop-2-enoic acid.
Molecular Properties
| Compound Name | methyl 2-methylidenebutanoate;prop-2-enoic acid |
| PubChem CID | 141257126 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | methyl 2-methylidenebutanoate;prop-2-enoic acid |
| SMILES | C=C(CC)C(=O)OC.C=CC(=O)O |
| InChI | InChI=1S/C6H10O2.C3H4O2/c1-4-5(2)6(7)8-3;1-2-3(4)5/h2,4H2,1,3H3;2H,1H2,(H,4,5) |
| InChIKey | WUMSVTXXFFCNOB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methylidenebutanoate;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylidenebutanoate;prop-2-enoic acid?
The IUPAC name of methyl 2-methylidenebutanoate;prop-2-enoic acid (CID 141257126) is methyl 2-methylidenebutanoate;prop-2-enoic acid.
What is the SMILES notation for methyl 2-methylidenebutanoate;prop-2-enoic acid?
The canonical SMILES for methyl 2-methylidenebutanoate;prop-2-enoic acid is C=C(CC)C(=O)OC.C=CC(=O)O.
What is the InChIKey of methyl 2-methylidenebutanoate;prop-2-enoic acid?
The InChIKey is WUMSVTXXFFCNOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C3H4O2/c1-4-5(2)6(7)8-3;1-2-3(4)5/h2,4H2,1,3H3;2H,1H2,(H,4,5).
What are the key properties of methyl 2-methylidenebutanoate;prop-2-enoic acid?
methyl 2-methylidenebutanoate;prop-2-enoic acid has a molecular weight of 186.21 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylidenebutanoate;prop-2-enoic acid is sourced from PubChem (CID 141257126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).