C47H44Cl2N12O — CID 141257547
1,3-bis[1-[3-(2-aminopyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]piperidin-4-yl]-1,3-bis(4-chlorophenyl)propan-2-one (PubChem CID 141257547) has the molecular formula C47H44Cl2N12O and a molecular weight of 863.86 g/mol. Its IUPAC name is 1,3-bis[1-[3-(2-aminopyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]piperidin-4-yl]-1,3-bis(4-chlorophenyl)propan-2-one.
| Compound Name | 1,3-bis[1-[3-(2-aminopyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]piperidin-4-yl]-1,3-bis(4-chlorophenyl)propan-2-one |
|---|---|
| PubChem CID | 141257547 |
| Molecular Formula | C47H44Cl2N12O |
| Molecular Weight | 863.86 g/mol |
| Exact Mass | 862.31 |
| IUPAC Name | 1,3-bis[1-[3-(2-aminopyrimidin-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]piperidin-4-yl]-1,3-bis(4-chlorophenyl)propan-2-one |
| SMILES | Nc1nccc(-c2c[nH]c3nccc(N4CCC(C(C(=O)C(c5ccc(Cl)cc5)C5CCN(c6ccnc7[nH]cc(-c8ccnc(N)n8)c67)CC5)c5ccc(Cl)cc5)CC4)c23)n1 |
| InChI | InChI=1S/C47H44Cl2N12O/c48-31-5-1-27(2-6-31)39(29-13-21-60(22-14-29)37-11-19-52-44-41(37)33(25-56-44)35-9-17-54-46(50)58-35)43(62)40(28-3-7-32(49)8-4-28)30-15-23-61(24-16-30)38-12-20-53-45-42(38)34(26-57-45)36-10-18-55-47(51)59-36/h1-12,17-20,25-26,29-30,39-40H,13-16,21-24H2,(H,52,56)(H,53,57)(H2,50,54,58)(H2,51,55,59) |
| InChIKey | DDEUQXVQEPDHMN-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 184.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.86 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |