C16H24N2O2 — CID 141257564
(2E)-1-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]-3-ethylocta-2,5-diene-1,4-dione (PubChem CID 141257564) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (2E)-1-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]-3-ethylocta-2,5-diene-1,4-dione.
| Compound Name | (2E)-1-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]-3-ethylocta-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 141257564 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (2E)-1-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]-3-ethylocta-2,5-diene-1,4-dione |
| SMILES | CCC=CC(=O)/C(=C/C(=O)N1C[C@@H]2CN[C@@H](C2)C1)CC |
| InChI | InChI=1S/C16H24N2O2/c1-3-5-6-15(19)13(4-2)8-16(20)18-10-12-7-14(11-18)17-9-12/h5-6,8,12,14,17H,3-4,7,9-11H2,1-2H3/b6-5?,13-8+/t12-,14-/m0/s1 |
| InChIKey | JPJCWNYQCUWWBS-LGXOLTICSA-N |
| XLogP | 1.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|