C15H25N — CID 141258361
1-(1,3,3,5,5-pentamethylcyclohexyl)pyrrole (PubChem CID 141258361) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 1-(1,3,3,5,5-pentamethylcyclohexyl)pyrrole.
| Compound Name | 1-(1,3,3,5,5-pentamethylcyclohexyl)pyrrole |
|---|---|
| PubChem CID | 141258361 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 1-(1,3,3,5,5-pentamethylcyclohexyl)pyrrole |
| SMILES | CC1(C)CC(C)(C)CC(C)(n2cccc2)C1 |
| InChI | InChI=1S/C15H25N/c1-13(2)10-14(3,4)12-15(5,11-13)16-8-6-7-9-16/h6-9H,10-12H2,1-5H3 |
| InChIKey | PKQKCRNJJOTGBO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |