C11H18N2O2 — CID 141258595
(E)-4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]but-2-enoic acid (PubChem CID 141258595) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (E)-4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]but-2-enoic acid.
| Compound Name | (E)-4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 141258595 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (E)-4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]but-2-enoic acid |
| SMILES | O=C(O)/C=C/CN1CCN2CCC[C@@H]2C1 |
| InChI | InChI=1S/C11H18N2O2/c14-11(15)4-2-5-12-7-8-13-6-1-3-10(13)9-12/h2,4,10H,1,3,5-9H2,(H,14,15)/b4-2+/t10-/m1/s1 |
| InChIKey | VUAPSSWHPSZGNM-XCRNYIDWSA-N |
| XLogP | 0.41 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|