About 3-(3H-dithiol-4-yl)-1,2,5-thiadiazole
3-(3H-dithiol-4-yl)-1,2,5-thiadiazole (PubChem CID 141258916) has the molecular formula C5H4N2S3
and a molecular weight of 188.30 g/mol. Its IUPAC name is 3-(3H-dithiol-4-yl)-1,2,5-thiadiazole.
Molecular Properties
| Compound Name | 3-(3H-dithiol-4-yl)-1,2,5-thiadiazole |
| PubChem CID | 141258916 |
| Molecular Formula | C5H4N2S3 |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 187.95 |
| IUPAC Name | 3-(3H-dithiol-4-yl)-1,2,5-thiadiazole |
| SMILES | C1=C(c2cnsn2)CSS1 |
| InChI | InChI=1S/C5H4N2S3/c1-5(7-10-6-1)4-2-8-9-3-4/h1-2H,3H2 |
| InChIKey | VMWWMHXMAVFKJE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3H-dithiol-4-yl)-1,2,5-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3H-dithiol-4-yl)-1,2,5-thiadiazole?
The IUPAC name of 3-(3H-dithiol-4-yl)-1,2,5-thiadiazole (CID 141258916) is 3-(3H-dithiol-4-yl)-1,2,5-thiadiazole.
What is the SMILES notation for 3-(3H-dithiol-4-yl)-1,2,5-thiadiazole?
The canonical SMILES for 3-(3H-dithiol-4-yl)-1,2,5-thiadiazole is C1=C(c2cnsn2)CSS1.
What is the InChIKey of 3-(3H-dithiol-4-yl)-1,2,5-thiadiazole?
The InChIKey is VMWWMHXMAVFKJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2S3/c1-5(7-10-6-1)4-2-8-9-3-4/h1-2H,3H2.
What are the key properties of 3-(3H-dithiol-4-yl)-1,2,5-thiadiazole?
3-(3H-dithiol-4-yl)-1,2,5-thiadiazole has a molecular weight of 188.30 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3H-dithiol-4-yl)-1,2,5-thiadiazole is sourced from PubChem (CID 141258916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).