About 6-(1,3-benzothiazol-2-yl)-9-ethylcarbazole-3-carbaldehyde
6-(1,3-benzothiazol-2-yl)-9-ethylcarbazole-3-carbaldehyde (PubChem CID 141259148) has the molecular formula C22H16N2OS
and a molecular weight of 356.45 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yl)-9-ethylcarbazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 6-(1,3-benzothiazol-2-yl)-9-ethylcarbazole-3-carbaldehyde |
| PubChem CID | 141259148 |
| Molecular Formula | C22H16N2OS |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yl)-9-ethylcarbazole-3-carbaldehyde |
| SMILES | CCn1c2ccc(C=O)cc2c2cc(-c3nc4ccccc4s3)ccc21 |
| InChI | InChI=1S/C22H16N2OS/c1-2-24-19-9-7-14(13-25)11-16(19)17-12-15(8-10-20(17)24)22-23-18-5-3-4-6-21(18)26-22/h3-13H,2H2,1H3 |
| InChIKey | DKRNPIDPIFRREW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-(1,3-benzothiazol-2-yl)-9-ethylcarbazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-benzothiazol-2-yl)-9-ethylcarbazole-3-carbaldehyde?
The IUPAC name of 6-(1,3-benzothiazol-2-yl)-9-ethylcarbazole-3-carbaldehyde (CID 141259148) is 6-(1,3-benzothiazol-2-yl)-9-ethylcarbazole-3-carbaldehyde.
What is the SMILES notation for 6-(1,3-benzothiazol-2-yl)-9-ethylcarbazole-3-carbaldehyde?
The canonical SMILES for 6-(1,3-benzothiazol-2-yl)-9-ethylcarbazole-3-carbaldehyde is CCn1c2ccc(C=O)cc2c2cc(-c3nc4ccccc4s3)ccc21.
What is the InChIKey of 6-(1,3-benzothiazol-2-yl)-9-ethylcarbazole-3-carbaldehyde?
The InChIKey is DKRNPIDPIFRREW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2OS/c1-2-24-19-9-7-14(13-25)11-16(19)17-12-15(8-10-20(17)24)22-23-18-5-3-4-6-21(18)26-22/h3-13H,2H2,1H3.
What are the key properties of 6-(1,3-benzothiazol-2-yl)-9-ethylcarbazole-3-carbaldehyde?
6-(1,3-benzothiazol-2-yl)-9-ethylcarbazole-3-carbaldehyde has a molecular weight of 356.45 g/mol, XLogP of 5.90, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-benzothiazol-2-yl)-9-ethylcarbazole-3-carbaldehyde is sourced from PubChem (CID 141259148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).