About 2-(2-amino-3,5-dibromophenyl)ethanol
2-(2-amino-3,5-dibromophenyl)ethanol (PubChem CID 141259371) has the molecular formula C8H9Br2NO
and a molecular weight of 294.97 g/mol. Its IUPAC name is 2-(2-amino-3,5-dibromophenyl)ethanol.
Molecular Properties
| Compound Name | 2-(2-amino-3,5-dibromophenyl)ethanol |
| PubChem CID | 141259371 |
| Molecular Formula | C8H9Br2NO |
| Molecular Weight | 294.97 g/mol |
| Exact Mass | 292.91 |
| IUPAC Name | 2-(2-amino-3,5-dibromophenyl)ethanol |
| SMILES | Nc1c(Br)cc(Br)cc1CCO |
| InChI | InChI=1S/C8H9Br2NO/c9-6-3-5(1-2-12)8(11)7(10)4-6/h3-4,12H,1-2,11H2 |
| InChIKey | UXOILFRJWFJHER-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.97 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-3,5-dibromophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-3,5-dibromophenyl)ethanol?
The IUPAC name of 2-(2-amino-3,5-dibromophenyl)ethanol (CID 141259371) is 2-(2-amino-3,5-dibromophenyl)ethanol.
What is the SMILES notation for 2-(2-amino-3,5-dibromophenyl)ethanol?
The canonical SMILES for 2-(2-amino-3,5-dibromophenyl)ethanol is Nc1c(Br)cc(Br)cc1CCO.
What is the InChIKey of 2-(2-amino-3,5-dibromophenyl)ethanol?
The InChIKey is UXOILFRJWFJHER-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Br2NO/c9-6-3-5(1-2-12)8(11)7(10)4-6/h3-4,12H,1-2,11H2.
What are the key properties of 2-(2-amino-3,5-dibromophenyl)ethanol?
2-(2-amino-3,5-dibromophenyl)ethanol has a molecular weight of 294.97 g/mol, XLogP of 2.33, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-3,5-dibromophenyl)ethanol is sourced from PubChem (CID 141259371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).