C13H14BrIN6O2 — CID 141259623
5-[4-(2-aminoethylamino)-1H-pyrazol-5-yl]-4-[(4-bromofuran-2-yl)methyl]-2-iodo-4H-pyrazol-3-one (PubChem CID 141259623) has the molecular formula C13H14BrIN6O2 and a molecular weight of 493.10 g/mol. Its IUPAC name is 5-[4-(2-aminoethylamino)-1H-pyrazol-5-yl]-4-[(4-bromofuran-2-yl)methyl]-2-iodo-4H-pyrazol-3-one.
| Compound Name | 5-[4-(2-aminoethylamino)-1H-pyrazol-5-yl]-4-[(4-bromofuran-2-yl)methyl]-2-iodo-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 141259623 |
| Molecular Formula | C13H14BrIN6O2 |
| Molecular Weight | 493.10 g/mol |
| Exact Mass | 491.94 |
| IUPAC Name | 5-[4-(2-aminoethylamino)-1H-pyrazol-5-yl]-4-[(4-bromofuran-2-yl)methyl]-2-iodo-4H-pyrazol-3-one |
| SMILES | NCCNc1cn[nH]c1C1=NN(I)C(=O)C1Cc1cc(Br)co1 |
| InChI | InChI=1S/C13H14BrIN6O2/c14-7-3-8(23-6-7)4-9-11(20-21(15)13(9)22)12-10(5-18-19-12)17-2-1-16/h3,5-6,9,17H,1-2,4,16H2,(H,18,19) |
| InChIKey | RYXWDCNUTGNHKQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.10 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|