About 2-(ethenoxymethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol
2-(ethenoxymethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 141259817) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-(ethenoxymethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
Molecular Properties
| Compound Name | 2-(ethenoxymethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| PubChem CID | 141259817 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-(ethenoxymethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | C=COCC1(O)CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C13H22O2/c1-5-15-9-13(14)8-10-6-7-12(13,4)11(10,2)3/h5,10,14H,1,6-9H2,2-4H3 |
| InChIKey | KTNYLJSRGMSTJB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-(ethenoxymethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethenoxymethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol?
The IUPAC name of 2-(ethenoxymethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (CID 141259817) is 2-(ethenoxymethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
What is the SMILES notation for 2-(ethenoxymethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol?
The canonical SMILES for 2-(ethenoxymethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol is C=COCC1(O)CC2CCC1(C)C2(C)C.
What is the InChIKey of 2-(ethenoxymethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol?
The InChIKey is KTNYLJSRGMSTJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-5-15-9-13(14)8-10-6-7-12(13,4)11(10,2)3/h5,10,14H,1,6-9H2,2-4H3.
What are the key properties of 2-(ethenoxymethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol?
2-(ethenoxymethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol has a molecular weight of 210.32 g/mol, XLogP of 2.72, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethenoxymethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol is sourced from PubChem (CID 141259817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).