About 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylimidazole-2-carbaldehyde
1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylimidazole-2-carbaldehyde (PubChem CID 141260180) has the molecular formula C11H12N2O3S
and a molecular weight of 252.30 g/mol. Its IUPAC name is 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylimidazole-2-carbaldehyde.
Molecular Properties
| Compound Name | 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylimidazole-2-carbaldehyde |
| PubChem CID | 141260180 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylimidazole-2-carbaldehyde |
| SMILES | CC1(S(=O)(=O)n2ccnc2C=O)C=CC=CC1 |
| InChI | InChI=1S/C11H12N2O3S/c1-11(5-3-2-4-6-11)17(15,16)13-8-7-12-10(13)9-14/h2-5,7-9H,6H2,1H3 |
| InChIKey | WYZKAIXPGCDIPM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylimidazole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylimidazole-2-carbaldehyde?
The IUPAC name of 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylimidazole-2-carbaldehyde (CID 141260180) is 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylimidazole-2-carbaldehyde.
What is the SMILES notation for 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylimidazole-2-carbaldehyde?
The canonical SMILES for 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylimidazole-2-carbaldehyde is CC1(S(=O)(=O)n2ccnc2C=O)C=CC=CC1.
What is the InChIKey of 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylimidazole-2-carbaldehyde?
The InChIKey is WYZKAIXPGCDIPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3S/c1-11(5-3-2-4-6-11)17(15,16)13-8-7-12-10(13)9-14/h2-5,7-9H,6H2,1H3.
What are the key properties of 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylimidazole-2-carbaldehyde?
1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylimidazole-2-carbaldehyde has a molecular weight of 252.30 g/mol, XLogP of 1.15, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonylimidazole-2-carbaldehyde is sourced from PubChem (CID 141260180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).