C14H14Br11FO2 — CID 141260589
bromo 4,4,5,5,6,6,7,7,13,13-decabromo-13-fluoro-2-methyltridec-2-enoate (PubChem CID 141260589) has the molecular formula C14H14Br11FO2 and a molecular weight of 1112.21 g/mol. Its IUPAC name is bromo 4,4,5,5,6,6,7,7,13,13-decabromo-13-fluoro-2-methyltridec-2-enoate.
| Compound Name | bromo 4,4,5,5,6,6,7,7,13,13-decabromo-13-fluoro-2-methyltridec-2-enoate |
|---|---|
| PubChem CID | 141260589 |
| Molecular Formula | C14H14Br11FO2 |
| Molecular Weight | 1112.21 g/mol |
| Exact Mass | 1101.20 |
| IUPAC Name | bromo 4,4,5,5,6,6,7,7,13,13-decabromo-13-fluoro-2-methyltridec-2-enoate |
| SMILES | CC(=CC(Br)(Br)C(Br)(Br)C(Br)(Br)C(Br)(Br)CCCCCC(F)(Br)Br)C(=O)OBr |
| InChI | InChI=1S/C14H14Br11FO2/c1-8(9(27)28-25)7-11(17,18)14(23,24)13(21,22)10(15,16)5-3-2-4-6-12(19,20)26/h7H,2-6H2,1H3 |
| InChIKey | VSDGKSFYEHRVPQ-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1112.21 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|