C13H11N5O2S2 — CID 141260719
N-(4-methoxyphenyl)-N-[5-(4-methylthiadiazol-5-yl)-1,3,4-thiadiazol-2-yl]formamide (PubChem CID 141260719) has the molecular formula C13H11N5O2S2 and a molecular weight of 333.40 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N-[5-(4-methylthiadiazol-5-yl)-1,3,4-thiadiazol-2-yl]formamide.
| Compound Name | N-(4-methoxyphenyl)-N-[5-(4-methylthiadiazol-5-yl)-1,3,4-thiadiazol-2-yl]formamide |
|---|---|
| PubChem CID | 141260719 |
| Molecular Formula | C13H11N5O2S2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-(4-methoxyphenyl)-N-[5-(4-methylthiadiazol-5-yl)-1,3,4-thiadiazol-2-yl]formamide |
| SMILES | COc1ccc(N(C=O)c2nnc(-c3snnc3C)s2)cc1 |
| InChI | InChI=1S/C13H11N5O2S2/c1-8-11(22-17-14-8)12-15-16-13(21-12)18(7-19)9-3-5-10(20-2)6-4-9/h3-7H,1-2H3 |
| InChIKey | CMAXGLJXQLVPBT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 81.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|