About ethyl N-(ethoxycarbonylamino)-N-prop-2-enylcarbamate;hydrate
ethyl N-(ethoxycarbonylamino)-N-prop-2-enylcarbamate;hydrate (PubChem CID 141261132) has the molecular formula C9H18N2O5
and a molecular weight of 234.25 g/mol. Its IUPAC name is ethyl N-(ethoxycarbonylamino)-N-prop-2-enylcarbamate;hydrate.
Molecular Properties
| Compound Name | ethyl N-(ethoxycarbonylamino)-N-prop-2-enylcarbamate;hydrate |
| PubChem CID | 141261132 |
| Molecular Formula | C9H18N2O5 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | ethyl N-(ethoxycarbonylamino)-N-prop-2-enylcarbamate;hydrate |
| SMILES | C=CCN(NC(=O)OCC)C(=O)OCC.O |
| InChI | InChI=1S/C9H16N2O4.H2O/c1-4-7-11(9(13)15-6-3)10-8(12)14-5-2;/h4H,1,5-7H2,2-3H3,(H,10,12);1H2 |
| InChIKey | JSNMPGFROIMFEH-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-(ethoxycarbonylamino)-N-prop-2-enylcarbamate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(ethoxycarbonylamino)-N-prop-2-enylcarbamate;hydrate?
The IUPAC name of ethyl N-(ethoxycarbonylamino)-N-prop-2-enylcarbamate;hydrate (CID 141261132) is ethyl N-(ethoxycarbonylamino)-N-prop-2-enylcarbamate;hydrate.
What is the SMILES notation for ethyl N-(ethoxycarbonylamino)-N-prop-2-enylcarbamate;hydrate?
The canonical SMILES for ethyl N-(ethoxycarbonylamino)-N-prop-2-enylcarbamate;hydrate is C=CCN(NC(=O)OCC)C(=O)OCC.O.
What is the InChIKey of ethyl N-(ethoxycarbonylamino)-N-prop-2-enylcarbamate;hydrate?
The InChIKey is JSNMPGFROIMFEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O4.H2O/c1-4-7-11(9(13)15-6-3)10-8(12)14-5-2;/h4H,1,5-7H2,2-3H3,(H,10,12);1H2.
What are the key properties of ethyl N-(ethoxycarbonylamino)-N-prop-2-enylcarbamate;hydrate?
ethyl N-(ethoxycarbonylamino)-N-prop-2-enylcarbamate;hydrate has a molecular weight of 234.25 g/mol, XLogP of 0.47, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(ethoxycarbonylamino)-N-prop-2-enylcarbamate;hydrate is sourced from PubChem (CID 141261132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).