About 2-(6-methoxynaphthalen-2-yl)-3,5,5-trimethylmorpholine;hydrochloride
2-(6-methoxynaphthalen-2-yl)-3,5,5-trimethylmorpholine;hydrochloride (PubChem CID 141261152) has the molecular formula C18H24ClNO2
and a molecular weight of 321.85 g/mol. Its IUPAC name is 2-(6-methoxynaphthalen-2-yl)-3,5,5-trimethylmorpholine;hydrochloride.
Molecular Properties
| Compound Name | 2-(6-methoxynaphthalen-2-yl)-3,5,5-trimethylmorpholine;hydrochloride |
| PubChem CID | 141261152 |
| Molecular Formula | C18H24ClNO2 |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-(6-methoxynaphthalen-2-yl)-3,5,5-trimethylmorpholine;hydrochloride |
| SMILES | COc1ccc2cc(C3OCC(C)(C)NC3C)ccc2c1.Cl |
| InChI | InChI=1S/C18H23NO2.ClH/c1-12-17(21-11-18(2,3)19-12)15-6-5-14-10-16(20-4)8-7-13(14)9-15;/h5-10,12,17,19H,11H2,1-4H3;1H |
| InChIKey | JJOOFUXHBZWDAZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-methoxynaphthalen-2-yl)-3,5,5-trimethylmorpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methoxynaphthalen-2-yl)-3,5,5-trimethylmorpholine;hydrochloride?
The IUPAC name of 2-(6-methoxynaphthalen-2-yl)-3,5,5-trimethylmorpholine;hydrochloride (CID 141261152) is 2-(6-methoxynaphthalen-2-yl)-3,5,5-trimethylmorpholine;hydrochloride.
What is the SMILES notation for 2-(6-methoxynaphthalen-2-yl)-3,5,5-trimethylmorpholine;hydrochloride?
The canonical SMILES for 2-(6-methoxynaphthalen-2-yl)-3,5,5-trimethylmorpholine;hydrochloride is COc1ccc2cc(C3OCC(C)(C)NC3C)ccc2c1.Cl.
What is the InChIKey of 2-(6-methoxynaphthalen-2-yl)-3,5,5-trimethylmorpholine;hydrochloride?
The InChIKey is JJOOFUXHBZWDAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO2.ClH/c1-12-17(21-11-18(2,3)19-12)15-6-5-14-10-16(20-4)8-7-13(14)9-15;/h5-10,12,17,19H,11H2,1-4H3;1H.
What are the key properties of 2-(6-methoxynaphthalen-2-yl)-3,5,5-trimethylmorpholine;hydrochloride?
2-(6-methoxynaphthalen-2-yl)-3,5,5-trimethylmorpholine;hydrochloride has a molecular weight of 321.85 g/mol, XLogP of 4.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methoxynaphthalen-2-yl)-3,5,5-trimethylmorpholine;hydrochloride is sourced from PubChem (CID 141261152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).