C14H19NaO3S — CID 141261386
sodium 1,2,3,4,4a,5,6,7,10,10a-decahydroanthracene-1-sulfonate (PubChem CID 141261386) has the molecular formula C14H19NaO3S and a molecular weight of 290.36 g/mol. Its IUPAC name is sodium 1,2,3,4,4a,5,6,7,10,10a-decahydroanthracene-1-sulfonate.
| Compound Name | sodium 1,2,3,4,4a,5,6,7,10,10a-decahydroanthracene-1-sulfonate |
|---|---|
| PubChem CID | 141261386 |
| Molecular Formula | C14H19NaO3S |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | sodium 1,2,3,4,4a,5,6,7,10,10a-decahydroanthracene-1-sulfonate |
| SMILES | O=S(=O)([O-])C1CCCC2CC3CCCC=C3C=C21.[Na+] |
| InChI | InChI=1S/C14H20O3S.Na/c15-18(16,17)14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14;/h5,9-10,12,14H,1-4,6-8H2,(H,15,16,17);/q;+1/p-1 |
| InChIKey | BGHQWSQDKZQRAK-UHFFFAOYSA-M |
| XLogP | -0.24 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|