About 2,6-diamino-1H-pyrimidine-4-thione;pyrimidin-2-amine
2,6-diamino-1H-pyrimidine-4-thione;pyrimidin-2-amine (PubChem CID 141261421) has the molecular formula C8H11N7S
and a molecular weight of 237.29 g/mol. Its IUPAC name is 2,6-diamino-1H-pyrimidine-4-thione;pyrimidin-2-amine.
Molecular Properties
| Compound Name | 2,6-diamino-1H-pyrimidine-4-thione;pyrimidin-2-amine |
| PubChem CID | 141261421 |
| Molecular Formula | C8H11N7S |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2,6-diamino-1H-pyrimidine-4-thione;pyrimidin-2-amine |
| SMILES | Nc1cc(=S)nc(N)[nH]1.Nc1ncccn1 |
| InChI | InChI=1S/C4H6N4S.C4H5N3/c5-2-1-3(9)8-4(6)7-2;5-4-6-2-1-3-7-4/h1H,(H5,5,6,7,8,9);1-3H,(H2,5,6,7) |
| InChIKey | OWZHJIMWFTZVHT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diamino-1H-pyrimidine-4-thione;pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diamino-1H-pyrimidine-4-thione;pyrimidin-2-amine?
The IUPAC name of 2,6-diamino-1H-pyrimidine-4-thione;pyrimidin-2-amine (CID 141261421) is 2,6-diamino-1H-pyrimidine-4-thione;pyrimidin-2-amine.
What is the SMILES notation for 2,6-diamino-1H-pyrimidine-4-thione;pyrimidin-2-amine?
The canonical SMILES for 2,6-diamino-1H-pyrimidine-4-thione;pyrimidin-2-amine is Nc1cc(=S)nc(N)[nH]1.Nc1ncccn1.
What is the InChIKey of 2,6-diamino-1H-pyrimidine-4-thione;pyrimidin-2-amine?
The InChIKey is OWZHJIMWFTZVHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4S.C4H5N3/c5-2-1-3(9)8-4(6)7-2;5-4-6-2-1-3-7-4/h1H,(H5,5,6,7,8,9);1-3H,(H2,5,6,7).
What are the key properties of 2,6-diamino-1H-pyrimidine-4-thione;pyrimidin-2-amine?
2,6-diamino-1H-pyrimidine-4-thione;pyrimidin-2-amine has a molecular weight of 237.29 g/mol, XLogP of 0.36, 0 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diamino-1H-pyrimidine-4-thione;pyrimidin-2-amine is sourced from PubChem (CID 141261421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).