C23H20N2O3S — CID 141261492
2-phenyl-5-pyridin-4-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazole (PubChem CID 141261492) has the molecular formula C23H20N2O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-phenyl-5-pyridin-4-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazole.
| Compound Name | 2-phenyl-5-pyridin-4-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 141261492 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-phenyl-5-pyridin-4-yl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazole |
| SMILES | COc1cc(-c2nc(-c3ccccc3)sc2-c2ccncc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H20N2O3S/c1-26-18-13-17(14-19(27-2)21(18)28-3)20-22(15-9-11-24-12-10-15)29-23(25-20)16-7-5-4-6-8-16/h4-14H,1-3H3 |
| InChIKey | UDDIDUNKEJKASC-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |