C16H16ClN5O4 — CID 141261528
methyl (2R)-1-(2-chloro-5-nitropyrimidin-4-yl)-4-phenylpiperazine-2-carboxylate (PubChem CID 141261528) has the molecular formula C16H16ClN5O4 and a molecular weight of 377.79 g/mol. Its IUPAC name is methyl (2R)-1-(2-chloro-5-nitropyrimidin-4-yl)-4-phenylpiperazine-2-carboxylate.
| Compound Name | methyl (2R)-1-(2-chloro-5-nitropyrimidin-4-yl)-4-phenylpiperazine-2-carboxylate |
|---|---|
| PubChem CID | 141261528 |
| Molecular Formula | C16H16ClN5O4 |
| Molecular Weight | 377.79 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | methyl (2R)-1-(2-chloro-5-nitropyrimidin-4-yl)-4-phenylpiperazine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CN(c2ccccc2)CCN1c1nc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16ClN5O4/c1-26-15(23)13-10-20(11-5-3-2-4-6-11)7-8-21(13)14-12(22(24)25)9-18-16(17)19-14/h2-6,9,13H,7-8,10H2,1H3/t13-/m1/s1 |
| InChIKey | AYOYSVIEWTTWFK-CYBMUJFWSA-N |
| XLogP | 1.91 |
| TPSA | 101.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.79 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|