C27H50O4 — CID 141262807
2-(17-methyloctadecan-8-yloxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 141262807) has the molecular formula C27H50O4 and a molecular weight of 438.69 g/mol. Its IUPAC name is 2-(17-methyloctadecan-8-yloxycarbonyl)cyclohexane-1-carboxylic acid.
| Compound Name | 2-(17-methyloctadecan-8-yloxycarbonyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 141262807 |
| Molecular Formula | C27H50O4 |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 438.37 |
| IUPAC Name | 2-(17-methyloctadecan-8-yloxycarbonyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCCCCC(CCCCCCCCC(C)C)OC(=O)C1CCCCC1C(=O)O |
| InChI | InChI=1S/C27H50O4/c1-4-5-6-9-13-18-23(19-14-11-8-7-10-12-17-22(2)3)31-27(30)25-21-16-15-20-24(25)26(28)29/h22-25H,4-21H2,1-3H3,(H,28,29) |
| InChIKey | ZWFSTPWPXABELT-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|