C22H20F3N3O4S — CID 141263113
[(3S)-5-amino-3'-(3,3-dimethylbut-1-ynyl)spiro[1,2-dihydropyrrole-3,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate (PubChem CID 141263113) has the molecular formula C22H20F3N3O4S and a molecular weight of 479.48 g/mol. Its IUPAC name is [(3S)-5-amino-3'-(3,3-dimethylbut-1-ynyl)spiro[1,2-dihydropyrrole-3,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate.
| Compound Name | [(3S)-5-amino-3'-(3,3-dimethylbut-1-ynyl)spiro[1,2-dihydropyrrole-3,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 141263113 |
| Molecular Formula | C22H20F3N3O4S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | [(3S)-5-amino-3'-(3,3-dimethylbut-1-ynyl)spiro[1,2-dihydropyrrole-3,5'-chromeno[2,3-b]pyridine]-7'-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)C#Cc1cnc2c(c1)[C@]1(C=C(N)NC1)c1cc(OS(=O)(=O)C(F)(F)F)ccc1O2 |
| InChI | InChI=1S/C22H20F3N3O4S/c1-20(2,3)7-6-13-8-16-19(27-11-13)31-17-5-4-14(32-33(29,30)22(23,24)25)9-15(17)21(16)10-18(26)28-12-21/h4-5,8-11,28H,12,26H2,1-3H3/t21-/m0/s1 |
| InChIKey | CEGLEIOHGNPQEB-NRFANRHFSA-N |
| XLogP | 3.50 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|