About methyl 4-sulfonylbutanoate
methyl 4-sulfonylbutanoate (PubChem CID 141263611) has the molecular formula C5H8O4S
and a molecular weight of 164.18 g/mol. Its IUPAC name is methyl 4-sulfonylbutanoate.
Molecular Properties
| Compound Name | methyl 4-sulfonylbutanoate |
| PubChem CID | 141263611 |
| Molecular Formula | C5H8O4S |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.01 |
| IUPAC Name | methyl 4-sulfonylbutanoate |
| SMILES | COC(=O)CCC=S(=O)=O |
| InChI | InChI=1S/C5H8O4S/c1-9-5(6)3-2-4-10(7)8/h4H,2-3H2,1H3 |
| InChIKey | QFUFZLYQEQPRRW-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-sulfonylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-sulfonylbutanoate?
The IUPAC name of methyl 4-sulfonylbutanoate (CID 141263611) is methyl 4-sulfonylbutanoate.
What is the SMILES notation for methyl 4-sulfonylbutanoate?
The canonical SMILES for methyl 4-sulfonylbutanoate is COC(=O)CCC=S(=O)=O.
What is the InChIKey of methyl 4-sulfonylbutanoate?
The InChIKey is QFUFZLYQEQPRRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4S/c1-9-5(6)3-2-4-10(7)8/h4H,2-3H2,1H3.
What are the key properties of methyl 4-sulfonylbutanoate?
methyl 4-sulfonylbutanoate has a molecular weight of 164.18 g/mol, XLogP of -0.38, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-sulfonylbutanoate is sourced from PubChem (CID 141263611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).