About 3-ethyl-2-(3-ethyl-3,4-dimethylpentan-2-yl)sulfonyl-3,4-dimethylpentane
3-ethyl-2-(3-ethyl-3,4-dimethylpentan-2-yl)sulfonyl-3,4-dimethylpentane (PubChem CID 141263746) has the molecular formula C18H38O2S
and a molecular weight of 318.57 g/mol. Its IUPAC name is 3-ethyl-2-(3-ethyl-3,4-dimethylpentan-2-yl)sulfonyl-3,4-dimethylpentane.
Molecular Properties
| Compound Name | 3-ethyl-2-(3-ethyl-3,4-dimethylpentan-2-yl)sulfonyl-3,4-dimethylpentane |
| PubChem CID | 141263746 |
| Molecular Formula | C18H38O2S |
| Molecular Weight | 318.57 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 3-ethyl-2-(3-ethyl-3,4-dimethylpentan-2-yl)sulfonyl-3,4-dimethylpentane |
| SMILES | CCC(C)(C(C)C)C(C)S(=O)(=O)C(C)C(C)(CC)C(C)C |
| InChI | InChI=1S/C18H38O2S/c1-11-17(9,13(3)4)15(7)21(19,20)16(8)18(10,12-2)14(5)6/h13-16H,11-12H2,1-10H3 |
| InChIKey | HCMMZPHODWMOJB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-2-(3-ethyl-3,4-dimethylpentan-2-yl)sulfonyl-3,4-dimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-(3-ethyl-3,4-dimethylpentan-2-yl)sulfonyl-3,4-dimethylpentane?
The IUPAC name of 3-ethyl-2-(3-ethyl-3,4-dimethylpentan-2-yl)sulfonyl-3,4-dimethylpentane (CID 141263746) is 3-ethyl-2-(3-ethyl-3,4-dimethylpentan-2-yl)sulfonyl-3,4-dimethylpentane.
What is the SMILES notation for 3-ethyl-2-(3-ethyl-3,4-dimethylpentan-2-yl)sulfonyl-3,4-dimethylpentane?
The canonical SMILES for 3-ethyl-2-(3-ethyl-3,4-dimethylpentan-2-yl)sulfonyl-3,4-dimethylpentane is CCC(C)(C(C)C)C(C)S(=O)(=O)C(C)C(C)(CC)C(C)C.
What is the InChIKey of 3-ethyl-2-(3-ethyl-3,4-dimethylpentan-2-yl)sulfonyl-3,4-dimethylpentane?
The InChIKey is HCMMZPHODWMOJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O2S/c1-11-17(9,13(3)4)15(7)21(19,20)16(8)18(10,12-2)14(5)6/h13-16H,11-12H2,1-10H3.
What are the key properties of 3-ethyl-2-(3-ethyl-3,4-dimethylpentan-2-yl)sulfonyl-3,4-dimethylpentane?
3-ethyl-2-(3-ethyl-3,4-dimethylpentan-2-yl)sulfonyl-3,4-dimethylpentane has a molecular weight of 318.57 g/mol, XLogP of 5.32, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-(3-ethyl-3,4-dimethylpentan-2-yl)sulfonyl-3,4-dimethylpentane is sourced from PubChem (CID 141263746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).