About 2-[6-(2-chloro-2,2-difluoroethyl)-2-oxo-3H-azepin-1-yl]butanamide
2-[6-(2-chloro-2,2-difluoroethyl)-2-oxo-3H-azepin-1-yl]butanamide (PubChem CID 141264573) has the molecular formula C12H15ClF2N2O2
and a molecular weight of 292.71 g/mol. Its IUPAC name is 2-[6-(2-chloro-2,2-difluoroethyl)-2-oxo-3H-azepin-1-yl]butanamide.
Molecular Properties
| Compound Name | 2-[6-(2-chloro-2,2-difluoroethyl)-2-oxo-3H-azepin-1-yl]butanamide |
| PubChem CID | 141264573 |
| Molecular Formula | C12H15ClF2N2O2 |
| Molecular Weight | 292.71 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-[6-(2-chloro-2,2-difluoroethyl)-2-oxo-3H-azepin-1-yl]butanamide |
| SMILES | CCC(C(N)=O)N1C=C(CC(F)(F)Cl)C=CCC1=O |
| InChI | InChI=1S/C12H15ClF2N2O2/c1-2-9(11(16)19)17-7-8(6-12(13,14)15)4-3-5-10(17)18/h3-4,7,9H,2,5-6H2,1H3,(H2,16,19) |
| InChIKey | GBUWGHXFUXMRPF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.71 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-(2-chloro-2,2-difluoroethyl)-2-oxo-3H-azepin-1-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(2-chloro-2,2-difluoroethyl)-2-oxo-3H-azepin-1-yl]butanamide?
The IUPAC name of 2-[6-(2-chloro-2,2-difluoroethyl)-2-oxo-3H-azepin-1-yl]butanamide (CID 141264573) is 2-[6-(2-chloro-2,2-difluoroethyl)-2-oxo-3H-azepin-1-yl]butanamide.
What is the SMILES notation for 2-[6-(2-chloro-2,2-difluoroethyl)-2-oxo-3H-azepin-1-yl]butanamide?
The canonical SMILES for 2-[6-(2-chloro-2,2-difluoroethyl)-2-oxo-3H-azepin-1-yl]butanamide is CCC(C(N)=O)N1C=C(CC(F)(F)Cl)C=CCC1=O.
What is the InChIKey of 2-[6-(2-chloro-2,2-difluoroethyl)-2-oxo-3H-azepin-1-yl]butanamide?
The InChIKey is GBUWGHXFUXMRPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClF2N2O2/c1-2-9(11(16)19)17-7-8(6-12(13,14)15)4-3-5-10(17)18/h3-4,7,9H,2,5-6H2,1H3,(H2,16,19).
What are the key properties of 2-[6-(2-chloro-2,2-difluoroethyl)-2-oxo-3H-azepin-1-yl]butanamide?
2-[6-(2-chloro-2,2-difluoroethyl)-2-oxo-3H-azepin-1-yl]butanamide has a molecular weight of 292.71 g/mol, XLogP of 2.14, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(2-chloro-2,2-difluoroethyl)-2-oxo-3H-azepin-1-yl]butanamide is sourced from PubChem (CID 141264573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).