C13H13F3N2O2 — CID 141264588
2-[2-oxo-6-(3,3,3-trifluoroprop-1-ynyl)-3H-azepin-1-yl]butanamide (PubChem CID 141264588) has the molecular formula C13H13F3N2O2 and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-[2-oxo-6-(3,3,3-trifluoroprop-1-ynyl)-3H-azepin-1-yl]butanamide.
| Compound Name | 2-[2-oxo-6-(3,3,3-trifluoroprop-1-ynyl)-3H-azepin-1-yl]butanamide |
|---|---|
| PubChem CID | 141264588 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-[2-oxo-6-(3,3,3-trifluoroprop-1-ynyl)-3H-azepin-1-yl]butanamide |
| SMILES | CCC(C(N)=O)N1C=C(C#CC(F)(F)F)C=CCC1=O |
| InChI | InChI=1S/C13H13F3N2O2/c1-2-10(12(17)20)18-8-9(4-3-5-11(18)19)6-7-13(14,15)16/h3-4,8,10H,2,5H2,1H3,(H2,17,20) |
| InChIKey | BBCMECWMBPRNRE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|