About 2-ethyl-4H-pyran-3-ol
2-ethyl-4H-pyran-3-ol (PubChem CID 141264885) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is 2-ethyl-4H-pyran-3-ol.
Molecular Properties
| Compound Name | 2-ethyl-4H-pyran-3-ol |
| PubChem CID | 141264885 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 2-ethyl-4H-pyran-3-ol |
| SMILES | CCC1=C(O)CC=CO1 |
| InChI | InChI=1S/C7H10O2/c1-2-7-6(8)4-3-5-9-7/h3,5,8H,2,4H2,1H3 |
| InChIKey | MUFRBPQBGLVSQE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-4H-pyran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4H-pyran-3-ol?
The IUPAC name of 2-ethyl-4H-pyran-3-ol (CID 141264885) is 2-ethyl-4H-pyran-3-ol.
What is the SMILES notation for 2-ethyl-4H-pyran-3-ol?
The canonical SMILES for 2-ethyl-4H-pyran-3-ol is CCC1=C(O)CC=CO1.
What is the InChIKey of 2-ethyl-4H-pyran-3-ol?
The InChIKey is MUFRBPQBGLVSQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-2-7-6(8)4-3-5-9-7/h3,5,8H,2,4H2,1H3.
What are the key properties of 2-ethyl-4H-pyran-3-ol?
2-ethyl-4H-pyran-3-ol has a molecular weight of 126.15 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4H-pyran-3-ol is sourced from PubChem (CID 141264885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).