C15H16F3N3 — CID 141265995
2,2,2-trifluoro-N-(1,2,3,4-tetrahydrobenzo[h][1,6]naphthyridin-8-ylmethyl)ethanamine (PubChem CID 141265995) has the molecular formula C15H16F3N3 and a molecular weight of 295.31 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(1,2,3,4-tetrahydrobenzo[h][1,6]naphthyridin-8-ylmethyl)ethanamine.
| Compound Name | 2,2,2-trifluoro-N-(1,2,3,4-tetrahydrobenzo[h][1,6]naphthyridin-8-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 141265995 |
| Molecular Formula | C15H16F3N3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2,2,2-trifluoro-N-(1,2,3,4-tetrahydrobenzo[h][1,6]naphthyridin-8-ylmethyl)ethanamine |
| SMILES | FC(F)(F)CNCc1ccc2c3c(cnc2c1)CCCN3 |
| InChI | InChI=1S/C15H16F3N3/c16-15(17,18)9-19-7-10-3-4-12-13(6-10)21-8-11-2-1-5-20-14(11)12/h3-4,6,8,19-20H,1-2,5,7,9H2 |
| InChIKey | XUQMMDOKCJPGFE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |