About 3-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]benzimidazol-5-ol
3-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]benzimidazol-5-ol (PubChem CID 141266607) has the molecular formula C16H10ClN3OS
and a molecular weight of 327.80 g/mol. Its IUPAC name is 3-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]benzimidazol-5-ol.
Molecular Properties
| Compound Name | 3-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]benzimidazol-5-ol |
| PubChem CID | 141266607 |
| Molecular Formula | C16H10ClN3OS |
| Molecular Weight | 327.80 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 3-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]benzimidazol-5-ol |
| SMILES | Oc1ccc2ncn(-c3nc(-c4cccc(Cl)c4)cs3)c2c1 |
| InChI | InChI=1S/C16H10ClN3OS/c17-11-3-1-2-10(6-11)14-8-22-16(19-14)20-9-18-13-5-4-12(21)7-15(13)20/h1-9,21H |
| InChIKey | QXTZMHRBEZXQBK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.80 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]benzimidazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]benzimidazol-5-ol?
The IUPAC name of 3-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]benzimidazol-5-ol (CID 141266607) is 3-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]benzimidazol-5-ol.
What is the SMILES notation for 3-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]benzimidazol-5-ol?
The canonical SMILES for 3-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]benzimidazol-5-ol is Oc1ccc2ncn(-c3nc(-c4cccc(Cl)c4)cs3)c2c1.
What is the InChIKey of 3-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]benzimidazol-5-ol?
The InChIKey is QXTZMHRBEZXQBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClN3OS/c17-11-3-1-2-10(6-11)14-8-22-16(19-14)20-9-18-13-5-4-12(21)7-15(13)20/h1-9,21H.
What are the key properties of 3-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]benzimidazol-5-ol?
3-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]benzimidazol-5-ol has a molecular weight of 327.80 g/mol, XLogP of 4.51, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3-chlorophenyl)-1,3-thiazol-2-yl]benzimidazol-5-ol is sourced from PubChem (CID 141266607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).