C14H9Cl3N2O2 — CID 141267459
1-benzyl-5,6,7-trichloro-4-hydroxypyrrolo[1,2-b]pyridazin-2-one (PubChem CID 141267459) has the molecular formula C14H9Cl3N2O2 and a molecular weight of 343.60 g/mol. Its IUPAC name is 1-benzyl-5,6,7-trichloro-4-hydroxypyrrolo[1,2-b]pyridazin-2-one.
| Compound Name | 1-benzyl-5,6,7-trichloro-4-hydroxypyrrolo[1,2-b]pyridazin-2-one |
|---|---|
| PubChem CID | 141267459 |
| Molecular Formula | C14H9Cl3N2O2 |
| Molecular Weight | 343.60 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 1-benzyl-5,6,7-trichloro-4-hydroxypyrrolo[1,2-b]pyridazin-2-one |
| SMILES | O=c1cc(O)c2c(Cl)c(Cl)c(Cl)n2n1Cc1ccccc1 |
| InChI | InChI=1S/C14H9Cl3N2O2/c15-11-12(16)14(17)19-13(11)9(20)6-10(21)18(19)7-8-4-2-1-3-5-8/h1-6,20H,7H2 |
| InChIKey | JIOXMVXPFCWBHF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.60 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |