About 4-(2-chloro-4-fluorophenyl)-2-thiophen-2-yl-7,8-dihydroquinazoline
4-(2-chloro-4-fluorophenyl)-2-thiophen-2-yl-7,8-dihydroquinazoline (PubChem CID 141268235) has the molecular formula C18H12ClFN2S
and a molecular weight of 342.83 g/mol. Its IUPAC name is 4-(2-chloro-4-fluorophenyl)-2-thiophen-2-yl-7,8-dihydroquinazoline.
Molecular Properties
| Compound Name | 4-(2-chloro-4-fluorophenyl)-2-thiophen-2-yl-7,8-dihydroquinazoline |
| PubChem CID | 141268235 |
| Molecular Formula | C18H12ClFN2S |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 4-(2-chloro-4-fluorophenyl)-2-thiophen-2-yl-7,8-dihydroquinazoline |
| SMILES | Fc1ccc(-c2nc(-c3cccs3)nc3c2C=CCC3)c(Cl)c1 |
| InChI | InChI=1S/C18H12ClFN2S/c19-14-10-11(20)7-8-12(14)17-13-4-1-2-5-15(13)21-18(22-17)16-6-3-9-23-16/h1,3-4,6-10H,2,5H2 |
| InChIKey | VCSDNBCSOOJFCC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-chloro-4-fluorophenyl)-2-thiophen-2-yl-7,8-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloro-4-fluorophenyl)-2-thiophen-2-yl-7,8-dihydroquinazoline?
The IUPAC name of 4-(2-chloro-4-fluorophenyl)-2-thiophen-2-yl-7,8-dihydroquinazoline (CID 141268235) is 4-(2-chloro-4-fluorophenyl)-2-thiophen-2-yl-7,8-dihydroquinazoline.
What is the SMILES notation for 4-(2-chloro-4-fluorophenyl)-2-thiophen-2-yl-7,8-dihydroquinazoline?
The canonical SMILES for 4-(2-chloro-4-fluorophenyl)-2-thiophen-2-yl-7,8-dihydroquinazoline is Fc1ccc(-c2nc(-c3cccs3)nc3c2C=CCC3)c(Cl)c1.
What is the InChIKey of 4-(2-chloro-4-fluorophenyl)-2-thiophen-2-yl-7,8-dihydroquinazoline?
The InChIKey is VCSDNBCSOOJFCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClFN2S/c19-14-10-11(20)7-8-12(14)17-13-4-1-2-5-15(13)21-18(22-17)16-6-3-9-23-16/h1,3-4,6-10H,2,5H2.
What are the key properties of 4-(2-chloro-4-fluorophenyl)-2-thiophen-2-yl-7,8-dihydroquinazoline?
4-(2-chloro-4-fluorophenyl)-2-thiophen-2-yl-7,8-dihydroquinazoline has a molecular weight of 342.83 g/mol, XLogP of 5.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloro-4-fluorophenyl)-2-thiophen-2-yl-7,8-dihydroquinazoline is sourced from PubChem (CID 141268235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).