About 2-cyclopentylsulfonyl-2,3-dihydro-1H-pyrrole
2-cyclopentylsulfonyl-2,3-dihydro-1H-pyrrole (PubChem CID 141268686) has the molecular formula C9H15NO2S
and a molecular weight of 201.29 g/mol. Its IUPAC name is 2-cyclopentylsulfonyl-2,3-dihydro-1H-pyrrole.
Molecular Properties
| Compound Name | 2-cyclopentylsulfonyl-2,3-dihydro-1H-pyrrole |
| PubChem CID | 141268686 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 2-cyclopentylsulfonyl-2,3-dihydro-1H-pyrrole |
| SMILES | O=S(=O)(C1CCCC1)C1CC=CN1 |
| InChI | InChI=1S/C9H15NO2S/c11-13(12,8-4-1-2-5-8)9-6-3-7-10-9/h3,7-10H,1-2,4-6H2 |
| InChIKey | HGJXHMRGJQODQB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopentylsulfonyl-2,3-dihydro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentylsulfonyl-2,3-dihydro-1H-pyrrole?
The IUPAC name of 2-cyclopentylsulfonyl-2,3-dihydro-1H-pyrrole (CID 141268686) is 2-cyclopentylsulfonyl-2,3-dihydro-1H-pyrrole.
What is the SMILES notation for 2-cyclopentylsulfonyl-2,3-dihydro-1H-pyrrole?
The canonical SMILES for 2-cyclopentylsulfonyl-2,3-dihydro-1H-pyrrole is O=S(=O)(C1CCCC1)C1CC=CN1.
What is the InChIKey of 2-cyclopentylsulfonyl-2,3-dihydro-1H-pyrrole?
The InChIKey is HGJXHMRGJQODQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2S/c11-13(12,8-4-1-2-5-8)9-6-3-7-10-9/h3,7-10H,1-2,4-6H2.
What are the key properties of 2-cyclopentylsulfonyl-2,3-dihydro-1H-pyrrole?
2-cyclopentylsulfonyl-2,3-dihydro-1H-pyrrole has a molecular weight of 201.29 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylsulfonyl-2,3-dihydro-1H-pyrrole is sourced from PubChem (CID 141268686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).