About 8,8-difluorospiro[4.5]decane-1,4-diol
8,8-difluorospiro[4.5]decane-1,4-diol (PubChem CID 141269140) has the molecular formula C10H16F2O2
and a molecular weight of 206.23 g/mol. Its IUPAC name is 8,8-difluorospiro[4.5]decane-1,4-diol.
Molecular Properties
| Compound Name | 8,8-difluorospiro[4.5]decane-1,4-diol |
| PubChem CID | 141269140 |
| Molecular Formula | C10H16F2O2 |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 8,8-difluorospiro[4.5]decane-1,4-diol |
| SMILES | OC1CCC(O)C12CCC(F)(F)CC2 |
| InChI | InChI=1S/C10H16F2O2/c11-10(12)5-3-9(4-6-10)7(13)1-2-8(9)14/h7-8,13-14H,1-6H2 |
| InChIKey | UUJRKHYCDVDAJL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8,8-difluorospiro[4.5]decane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-difluorospiro[4.5]decane-1,4-diol?
The IUPAC name of 8,8-difluorospiro[4.5]decane-1,4-diol (CID 141269140) is 8,8-difluorospiro[4.5]decane-1,4-diol.
What is the SMILES notation for 8,8-difluorospiro[4.5]decane-1,4-diol?
The canonical SMILES for 8,8-difluorospiro[4.5]decane-1,4-diol is OC1CCC(O)C12CCC(F)(F)CC2.
What is the InChIKey of 8,8-difluorospiro[4.5]decane-1,4-diol?
The InChIKey is UUJRKHYCDVDAJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2O2/c11-10(12)5-3-9(4-6-10)7(13)1-2-8(9)14/h7-8,13-14H,1-6H2.
What are the key properties of 8,8-difluorospiro[4.5]decane-1,4-diol?
8,8-difluorospiro[4.5]decane-1,4-diol has a molecular weight of 206.23 g/mol, XLogP of 1.70, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-difluorospiro[4.5]decane-1,4-diol is sourced from PubChem (CID 141269140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).