C17H23NO — CID 141269165
6-methyl-3a,3b,4,8,9,9a,9b,10,11,11a-decahydro-3H-indeno[5,4-f]quinolin-7-one (PubChem CID 141269165) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 6-methyl-3a,3b,4,8,9,9a,9b,10,11,11a-decahydro-3H-indeno[5,4-f]quinolin-7-one.
| Compound Name | 6-methyl-3a,3b,4,8,9,9a,9b,10,11,11a-decahydro-3H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 141269165 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 6-methyl-3a,3b,4,8,9,9a,9b,10,11,11a-decahydro-3H-indeno[5,4-f]quinolin-7-one |
| SMILES | CN1C(=O)CCC2C1=CCC1C3CC=CC3CCC21 |
| InChI | InChI=1S/C17H23NO/c1-18-16-9-7-13-12-4-2-3-11(12)5-6-14(13)15(16)8-10-17(18)19/h2-3,9,11-15H,4-8,10H2,1H3 |
| InChIKey | FJXAGIRXPGOIPR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|