About pyrano[3,4-c]pyrazole-3-carboxamide
pyrano[3,4-c]pyrazole-3-carboxamide (PubChem CID 141269587) has the molecular formula C7H5N3O2
and a molecular weight of 163.14 g/mol. Its IUPAC name is pyrano[3,4-c]pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | pyrano[3,4-c]pyrazole-3-carboxamide |
| PubChem CID | 141269587 |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | pyrano[3,4-c]pyrazole-3-carboxamide |
| SMILES | NC(=O)c1nnc2coccc1-2 |
| InChI | InChI=1S/C7H5N3O2/c8-7(11)6-4-1-2-12-3-5(4)9-10-6/h1-3H,(H2,8,11) |
| InChIKey | BYKRMWALPODJOF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrano[3,4-c]pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrano[3,4-c]pyrazole-3-carboxamide?
The IUPAC name of pyrano[3,4-c]pyrazole-3-carboxamide (CID 141269587) is pyrano[3,4-c]pyrazole-3-carboxamide.
What is the SMILES notation for pyrano[3,4-c]pyrazole-3-carboxamide?
The canonical SMILES for pyrano[3,4-c]pyrazole-3-carboxamide is NC(=O)c1nnc2coccc1-2.
What is the InChIKey of pyrano[3,4-c]pyrazole-3-carboxamide?
The InChIKey is BYKRMWALPODJOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2/c8-7(11)6-4-1-2-12-3-5(4)9-10-6/h1-3H,(H2,8,11).
What are the key properties of pyrano[3,4-c]pyrazole-3-carboxamide?
pyrano[3,4-c]pyrazole-3-carboxamide has a molecular weight of 163.14 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrano[3,4-c]pyrazole-3-carboxamide is sourced from PubChem (CID 141269587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).