C11H20N2O — CID 141270619
2-amino-1-[(3S,4S)-2,2-dimethyl-4-prop-2-enylpyrrolidin-3-yl]ethanone (PubChem CID 141270619) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-amino-1-[(3S,4S)-2,2-dimethyl-4-prop-2-enylpyrrolidin-3-yl]ethanone.
| Compound Name | 2-amino-1-[(3S,4S)-2,2-dimethyl-4-prop-2-enylpyrrolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 141270619 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 2-amino-1-[(3S,4S)-2,2-dimethyl-4-prop-2-enylpyrrolidin-3-yl]ethanone |
| SMILES | C=CC[C@@H]1CNC(C)(C)[C@H]1C(=O)CN |
| InChI | InChI=1S/C11H20N2O/c1-4-5-8-7-13-11(2,3)10(8)9(14)6-12/h4,8,10,13H,1,5-7,12H2,2-3H3/t8-,10-/m1/s1 |
| InChIKey | RUFJSYBNQPQPRA-PSASIEDQSA-N |
| XLogP | 0.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|