About 2,3-bis[(3,4-dihydroxyphenyl)methylidene]-1-methylpiperidin-4-one
2,3-bis[(3,4-dihydroxyphenyl)methylidene]-1-methylpiperidin-4-one (PubChem CID 141270880) has the molecular formula C20H19NO5
and a molecular weight of 353.37 g/mol. Its IUPAC name is 2,3-bis[(3,4-dihydroxyphenyl)methylidene]-1-methylpiperidin-4-one.
Molecular Properties
| Compound Name | 2,3-bis[(3,4-dihydroxyphenyl)methylidene]-1-methylpiperidin-4-one |
| PubChem CID | 141270880 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2,3-bis[(3,4-dihydroxyphenyl)methylidene]-1-methylpiperidin-4-one |
| SMILES | CN1CCC(=O)C(=Cc2ccc(O)c(O)c2)C1=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C20H19NO5/c1-21-7-6-16(22)14(8-12-2-4-17(23)19(25)10-12)15(21)9-13-3-5-18(24)20(26)11-13/h2-5,8-11,23-26H,6-7H2,1H3 |
| InChIKey | KTCRPKCITPWGOI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis[(3,4-dihydroxyphenyl)methylidene]-1-methylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis[(3,4-dihydroxyphenyl)methylidene]-1-methylpiperidin-4-one?
The IUPAC name of 2,3-bis[(3,4-dihydroxyphenyl)methylidene]-1-methylpiperidin-4-one (CID 141270880) is 2,3-bis[(3,4-dihydroxyphenyl)methylidene]-1-methylpiperidin-4-one.
What is the SMILES notation for 2,3-bis[(3,4-dihydroxyphenyl)methylidene]-1-methylpiperidin-4-one?
The canonical SMILES for 2,3-bis[(3,4-dihydroxyphenyl)methylidene]-1-methylpiperidin-4-one is CN1CCC(=O)C(=Cc2ccc(O)c(O)c2)C1=Cc1ccc(O)c(O)c1.
What is the InChIKey of 2,3-bis[(3,4-dihydroxyphenyl)methylidene]-1-methylpiperidin-4-one?
The InChIKey is KTCRPKCITPWGOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO5/c1-21-7-6-16(22)14(8-12-2-4-17(23)19(25)10-12)15(21)9-13-3-5-18(24)20(26)11-13/h2-5,8-11,23-26H,6-7H2,1H3.
What are the key properties of 2,3-bis[(3,4-dihydroxyphenyl)methylidene]-1-methylpiperidin-4-one?
2,3-bis[(3,4-dihydroxyphenyl)methylidene]-1-methylpiperidin-4-one has a molecular weight of 353.37 g/mol, XLogP of 2.84, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis[(3,4-dihydroxyphenyl)methylidene]-1-methylpiperidin-4-one is sourced from PubChem (CID 141270880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).