C10H7ClFN3OS — CID 141271032
2-amino-N-(2-chloro-4-fluorophenyl)-1,3-thiazole-5-carboxamide (PubChem CID 141271032) has the molecular formula C10H7ClFN3OS and a molecular weight of 271.70 g/mol. Its IUPAC name is 2-amino-N-(2-chloro-4-fluorophenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-(2-chloro-4-fluorophenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 141271032 |
| Molecular Formula | C10H7ClFN3OS |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 2-amino-N-(2-chloro-4-fluorophenyl)-1,3-thiazole-5-carboxamide |
| SMILES | Nc1ncc(C(=O)Nc2ccc(F)cc2Cl)s1 |
| InChI | InChI=1S/C10H7ClFN3OS/c11-6-3-5(12)1-2-7(6)15-9(16)8-4-14-10(13)17-8/h1-4H,(H2,13,14)(H,15,16) |
| InChIKey | GZFIUFJZDQZAJS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |