About 2,2,2-trideuterioacetamide;trihydrochloride
2,2,2-trideuterioacetamide;trihydrochloride (PubChem CID 141271471) has the molecular formula C2H8Cl3NO
and a molecular weight of 171.47 g/mol. Its IUPAC name is 2,2,2-trideuterioacetamide;trihydrochloride.
Molecular Properties
| Compound Name | 2,2,2-trideuterioacetamide;trihydrochloride |
| PubChem CID | 141271471 |
| Molecular Formula | C2H8Cl3NO |
| Molecular Weight | 171.47 g/mol |
| Exact Mass | 169.99 |
| IUPAC Name | 2,2,2-trideuterioacetamide;trihydrochloride |
| SMILES | Cl.Cl.Cl.[2H]C([2H])([2H])C(N)=O |
| InChI | InChI=1S/C2H5NO.3ClH/c1-2(3)4;;;/h1H3,(H2,3,4);3*1H/i1D3;;; |
| InChIKey | FJGBZJASJGQMNZ-AGUGZIQGSA-N |
| XLogP | 0.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.47 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2,2-trideuterioacetamide;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trideuterioacetamide;trihydrochloride?
The IUPAC name of 2,2,2-trideuterioacetamide;trihydrochloride (CID 141271471) is 2,2,2-trideuterioacetamide;trihydrochloride.
What is the SMILES notation for 2,2,2-trideuterioacetamide;trihydrochloride?
The canonical SMILES for 2,2,2-trideuterioacetamide;trihydrochloride is Cl.Cl.Cl.[2H]C([2H])([2H])C(N)=O.
What is the InChIKey of 2,2,2-trideuterioacetamide;trihydrochloride?
The InChIKey is FJGBZJASJGQMNZ-AGUGZIQGSA-N. The full InChI is InChI=1S/C2H5NO.3ClH/c1-2(3)4;;;/h1H3,(H2,3,4);3*1H/i1D3;;;.
What are the key properties of 2,2,2-trideuterioacetamide;trihydrochloride?
2,2,2-trideuterioacetamide;trihydrochloride has a molecular weight of 171.47 g/mol, XLogP of 0.76, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trideuterioacetamide;trihydrochloride is sourced from PubChem (CID 141271471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).