C24H25N3O3 — CID 141271807
2-[3-[6-(4-hydroxy-3-methylphenyl)pyrimidin-4-yl]phenoxy]-1-piperidin-1-ylethanone (PubChem CID 141271807) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[3-[6-(4-hydroxy-3-methylphenyl)pyrimidin-4-yl]phenoxy]-1-piperidin-1-ylethanone.
| Compound Name | 2-[3-[6-(4-hydroxy-3-methylphenyl)pyrimidin-4-yl]phenoxy]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 141271807 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-[3-[6-(4-hydroxy-3-methylphenyl)pyrimidin-4-yl]phenoxy]-1-piperidin-1-ylethanone |
| SMILES | Cc1cc(-c2cc(-c3cccc(OCC(=O)N4CCCCC4)c3)ncn2)ccc1O |
| InChI | InChI=1S/C24H25N3O3/c1-17-12-19(8-9-23(17)28)22-14-21(25-16-26-22)18-6-5-7-20(13-18)30-15-24(29)27-10-3-2-4-11-27/h5-9,12-14,16,28H,2-4,10-11,15H2,1H3 |
| InChIKey | REHPIYMFOGNAGR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |