C33H62O3Si — CID 141272337
[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-triethoxysilane (PubChem CID 141272337) has the molecular formula C33H62O3Si and a molecular weight of 534.94 g/mol. Its IUPAC name is [(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-triethoxysilane.
| Compound Name | [(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-triethoxysilane |
|---|---|
| PubChem CID | 141272337 |
| Molecular Formula | C33H62O3Si |
| Molecular Weight | 534.94 g/mol |
| Exact Mass | 534.45 |
| IUPAC Name | [(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]-triethoxysilane |
| SMILES | CCO[Si](OCC)(OCC)C1CC[C@@]2(C)C(CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C33H62O3Si/c1-9-34-37(35-10-2,36-11-3)27-19-21-32(7)26(23-27)15-16-28-30-18-17-29(25(6)14-12-13-24(4)5)33(30,8)22-20-31(28)32/h24-31H,9-23H2,1-8H3/t25-,26?,27?,28+,29-,30+,31+,32+,33-/m1/s1 |
| InChIKey | UHARUEFHJAMVAH-CBIDQXEASA-N |
| XLogP | 9.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.94 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|