C16H13F3N2O5S — CID 141272440
6-(1,2,3,4-tetrahydroquinolin-7-yl)-3-(trifluoromethylsulfonyloxy)pyridine-2-carboxylic acid (PubChem CID 141272440) has the molecular formula C16H13F3N2O5S and a molecular weight of 402.35 g/mol. Its IUPAC name is 6-(1,2,3,4-tetrahydroquinolin-7-yl)-3-(trifluoromethylsulfonyloxy)pyridine-2-carboxylic acid.
| Compound Name | 6-(1,2,3,4-tetrahydroquinolin-7-yl)-3-(trifluoromethylsulfonyloxy)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 141272440 |
| Molecular Formula | C16H13F3N2O5S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 6-(1,2,3,4-tetrahydroquinolin-7-yl)-3-(trifluoromethylsulfonyloxy)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nc(-c2ccc3c(c2)NCCC3)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H13F3N2O5S/c17-16(18,19)27(24,25)26-13-6-5-11(21-14(13)15(22)23)10-4-3-9-2-1-7-20-12(9)8-10/h3-6,8,20H,1-2,7H2,(H,22,23) |
| InChIKey | JBKFTDNFBLMNEZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|