C13H21BN2O4S — CID 141272545
propyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid (PubChem CID 141272545) has the molecular formula C13H21BN2O4S and a molecular weight of 312.20 g/mol. Its IUPAC name is propyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid.
| Compound Name | propyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 141272545 |
| Molecular Formula | C13H21BN2O4S |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | propyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamic acid |
| SMILES | CCCN(C(=O)O)c1ncc(B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C13H21BN2O4S/c1-6-7-16(11(17)18)10-15-8-9(21-10)14-19-12(2,3)13(4,5)20-14/h8H,6-7H2,1-5H3,(H,17,18) |
| InChIKey | PIEKHJLUJWWJCF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|